Carboxylic acids and derivatives
Filtered Search Results
Methyl p-toluate, 99%
CAS: 99-75-2 MDL Number: MFCD00008441 InChI Key: QSSJZLPUHJDYKF-UHFFFAOYSA-N Synonym: methyl p-toluate,methyl-p-toluate,p-carbomethoxytoluene,methyl 4-toluate,4-methylbenzoic acid methyl ester,methyl p-methylbenzoate,benzoic acid, 4-methyl-, methyl ester,4-methoxycarbonyl toluene,p-toluic acid, methyl ester,methyl p-toluenecarboxylate PubChem CID: 7455 IUPAC Name: methyl 4-methylbenzoate SMILES: CC1=CC=C(C=C1)C(=O)OC
| PubChem CID | 7455 |
|---|---|
| CAS | 99-75-2 |
| MDL Number | MFCD00008441 |
| SMILES | CC1=CC=C(C=C1)C(=O)OC |
| Synonym | methyl p-toluate,methyl-p-toluate,p-carbomethoxytoluene,methyl 4-toluate,4-methylbenzoic acid methyl ester,methyl p-methylbenzoate,benzoic acid, 4-methyl-, methyl ester,4-methoxycarbonyl toluene,p-toluic acid, methyl ester,methyl p-toluenecarboxylate |
| IUPAC Name | methyl 4-methylbenzoate |
| InChI Key | QSSJZLPUHJDYKF-UHFFFAOYSA-N |
Citric acid, diammonium salt, 98+%, ACS reagent
CAS: 3012-65-5 Molecular Formula: C6H14N2O7 Molecular Weight (g/mol): 226.19 MDL Number: MFCD00013068 InChI Key: YXVFQADLFFNVDS-UHFFFAOYSA-N Synonym: ammonium citrate dibasic,ammonium hydrogencitrate,diammonium hydrogen citrate,citric acid diammonium salt,citric acid ammonium salt,di-ammonium hydrogen citrate,citro diamine,citric acid diamine,ammonium citrate, dibasic, acs,ammonium citrate dibasic, puriss PubChem CID: 13710713 ChEBI: CHEBI:63076 IUPAC Name: azane;2-hydroxypropane-1,2,3-tricarboxylic acid SMILES: [NH4+].[NH4+].OC(=O)C(O)(CC([O-])=O)CC([O-])=O
| PubChem CID | 13710713 |
|---|---|
| CAS | 3012-65-5 |
| Molecular Weight (g/mol) | 226.19 |
| ChEBI | CHEBI:63076 |
| MDL Number | MFCD00013068 |
| SMILES | [NH4+].[NH4+].OC(=O)C(O)(CC([O-])=O)CC([O-])=O |
| Synonym | ammonium citrate dibasic,ammonium hydrogencitrate,diammonium hydrogen citrate,citric acid diammonium salt,citric acid ammonium salt,di-ammonium hydrogen citrate,citro diamine,citric acid diamine,ammonium citrate, dibasic, acs,ammonium citrate dibasic, puriss |
| IUPAC Name | azane;2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChI Key | YXVFQADLFFNVDS-UHFFFAOYSA-N |
| Molecular Formula | C6H14N2O7 |
Thermo Scientific Chemicals Cefditoren pivoxyl
CAS: 117467-28-4 Molecular Formula: C25H28N6O7S3 Molecular Weight (g/mol): 620.71 MDL Number: MFCD00933166 InChI Key: AFZFFLVORLEPPO-UHFFFAOYNA-N IUPAC Name: {7-[2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetamido]-3-[2-(4-methyl-1,3-thiazol-5-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbonyloxy}methyl 2,2-dimethylpropanoate SMILES: CON=C(C(=O)NC1C2SCC(C=CC3=C(C)N=CS3)=C(N2C1=O)C(=O)OCOC(=O)C(C)(C)C)C1=CSC(N)=N1
| CAS | 117467-28-4 |
|---|---|
| Molecular Weight (g/mol) | 620.71 |
| MDL Number | MFCD00933166 |
| SMILES | CON=C(C(=O)NC1C2SCC(C=CC3=C(C)N=CS3)=C(N2C1=O)C(=O)OCOC(=O)C(C)(C)C)C1=CSC(N)=N1 |
| IUPAC Name | {7-[2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetamido]-3-[2-(4-methyl-1,3-thiazol-5-yl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbonyloxy}methyl 2,2-dimethylpropanoate |
| InChI Key | AFZFFLVORLEPPO-UHFFFAOYNA-N |
| Molecular Formula | C25H28N6O7S3 |
Nickel hydroxyacetate, Ni 27-29%, Thermo Scientific™
CAS: 41587-84-2 Molecular Formula: C4H6NiO6 Molecular Weight (g/mol): 208.779 MDL Number: MFCD00070414 InChI Key: OZHLXQFAHIYYDJ-UHFFFAOYSA-L Synonym: nickel hydroxyacetate,acmc-20ak3m,nickel 2+ diglycolate,nickel 2+ bis hydroxyacetate,nickel 2+ ion diglycolate,bis hydroxyacetic acid nickel ii salt,nickel, 2,2'-bipyridine-n,n' hydroxyacetato 2--o1,o2-9ci PubChem CID: 57349863 IUPAC Name: 2-hydroxyacetate;nickel(2+) SMILES: C(C(=O)[O-])O.C(C(=O)[O-])O.[Ni+2]
| PubChem CID | 57349863 |
|---|---|
| CAS | 41587-84-2 |
| Molecular Weight (g/mol) | 208.779 |
| MDL Number | MFCD00070414 |
| SMILES | C(C(=O)[O-])O.C(C(=O)[O-])O.[Ni+2] |
| Synonym | nickel hydroxyacetate,acmc-20ak3m,nickel 2+ diglycolate,nickel 2+ bis hydroxyacetate,nickel 2+ ion diglycolate,bis hydroxyacetic acid nickel ii salt,nickel, 2,2'-bipyridine-n,n' hydroxyacetato 2--o1,o2-9ci |
| IUPAC Name | 2-hydroxyacetate;nickel(2+) |
| InChI Key | OZHLXQFAHIYYDJ-UHFFFAOYSA-L |
| Molecular Formula | C4H6NiO6 |
Ethyl methacrylate, 98+%, stab. with 10-120ppm, 4-methoxyphenol
CAS: 97-63-2 Molecular Formula: C6H10O2 Molecular Weight (g/mol): 114.144 MDL Number: MFCD00009161 InChI Key: SUPCQIBBMFXVTL-UHFFFAOYSA-N Synonym: ethyl methacrylate,ethyl 2-methylacrylate,2-propenoic acid, 2-methyl-, ethyl ester,methacrylic acid ethyl ester,ethyl 2-methyl-2-propenoate,ethyl 2-methacrylate,rhoplex ac-33,methacrylic acid, ethyl ester,rcra waste number u118,2-methylacrylic acid, ethyl ester PubChem CID: 7343 IUPAC Name: ethyl 2-methylprop-2-enoate SMILES: CCOC(=O)C(=C)C
| PubChem CID | 7343 |
|---|---|
| CAS | 97-63-2 |
| Molecular Weight (g/mol) | 114.144 |
| MDL Number | MFCD00009161 |
| SMILES | CCOC(=O)C(=C)C |
| Synonym | ethyl methacrylate,ethyl 2-methylacrylate,2-propenoic acid, 2-methyl-, ethyl ester,methacrylic acid ethyl ester,ethyl 2-methyl-2-propenoate,ethyl 2-methacrylate,rhoplex ac-33,methacrylic acid, ethyl ester,rcra waste number u118,2-methylacrylic acid, ethyl ester |
| IUPAC Name | ethyl 2-methylprop-2-enoate |
| InChI Key | SUPCQIBBMFXVTL-UHFFFAOYSA-N |
| Molecular Formula | C6H10O2 |
Methyl Acetate, Technical, Approx. 75%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 79-20-9
| CAS | 79-20-9 |
|---|
Methyl DL-lactate, 99%
CAS: 547-64-8 Molecular Formula: C4H8O3 Molecular Weight (g/mol): 104.105 MDL Number: MFCD00066367 InChI Key: LPEKGGXMPWTOCB-UHFFFAOYSA-N Synonym: methyl lactate,dl-methyl lactate,methyl dl-lactate,lactic acid methyl ester,methyl 2-hydroxypropionate,lactic acid, methyl ester,+--methyl lactate,propanoic acid, 2-hydroxy-, methyl ester,methyl alpha-hydroxypropionate,methyl-lactate PubChem CID: 11040 ChEBI: CHEBI:83221 IUPAC Name: methyl 2-hydroxypropanoate SMILES: CC(C(=O)OC)O
| PubChem CID | 11040 |
|---|---|
| CAS | 547-64-8 |
| Molecular Weight (g/mol) | 104.105 |
| ChEBI | CHEBI:83221 |
| MDL Number | MFCD00066367 |
| SMILES | CC(C(=O)OC)O |
| Synonym | methyl lactate,dl-methyl lactate,methyl dl-lactate,lactic acid methyl ester,methyl 2-hydroxypropionate,lactic acid, methyl ester,+--methyl lactate,propanoic acid, 2-hydroxy-, methyl ester,methyl alpha-hydroxypropionate,methyl-lactate |
| IUPAC Name | methyl 2-hydroxypropanoate |
| InChI Key | LPEKGGXMPWTOCB-UHFFFAOYSA-N |
| Molecular Formula | C4H8O3 |
Methyl coumalate, 98%
CAS: 6018-41-3 Molecular Formula: C7H6O4 Molecular Weight (g/mol): 154.121 MDL Number: MFCD00010120 InChI Key: HHWWWZQYHPFCBY-UHFFFAOYSA-N Synonym: methyl coumalate,methyl 2-oxo-2h-pyran-5-carboxylate,coumalic acid, methyl ester,5-carbomethoxy-2-pyrone,2h-pyran-5-carboxylic acid, 2-oxo-, methyl ester,coumalic acid methyl ester,unii-1s7tmf0r8t,methyl 2-pyrone-5-carboxylate,methyl 2-oxopyran-5-carboxylate,1s7tmf0r8t PubChem CID: 80113 IUPAC Name: methyl 6-oxopyran-3-carboxylate SMILES: COC(=O)C1=COC(=O)C=C1
| PubChem CID | 80113 |
|---|---|
| CAS | 6018-41-3 |
| Molecular Weight (g/mol) | 154.121 |
| MDL Number | MFCD00010120 |
| SMILES | COC(=O)C1=COC(=O)C=C1 |
| Synonym | methyl coumalate,methyl 2-oxo-2h-pyran-5-carboxylate,coumalic acid, methyl ester,5-carbomethoxy-2-pyrone,2h-pyran-5-carboxylic acid, 2-oxo-, methyl ester,coumalic acid methyl ester,unii-1s7tmf0r8t,methyl 2-pyrone-5-carboxylate,methyl 2-oxopyran-5-carboxylate,1s7tmf0r8t |
| IUPAC Name | methyl 6-oxopyran-3-carboxylate |
| InChI Key | HHWWWZQYHPFCBY-UHFFFAOYSA-N |
| Molecular Formula | C7H6O4 |
N-(4-Bromobutyl)phthalimide, 98%
CAS: 5394-18-3 Molecular Formula: C12H12BrNO2 Molecular Weight (g/mol): 282.14 MDL Number: MFCD00005905 InChI Key: UXFWTIGUWHJKDD-UHFFFAOYSA-N Synonym: n-4-bromobutyl phthalimide,2-4-bromobutyl isoindoline-1,3-dione,1h-isoindole-1,3 2h-dione, 2-4-bromobutyl,2-4-bromobutyl-1h-isoindole-1,3 2h-dione,n-4-bromobutyl-phthalimide,2-4-bromobutyl isoindole-1,3-dione,2-4-bromobutyl-2,3-dihydro-1h-isoindole-1,3-dione,n-4-bromobutyl,n-bromobutylphthalimide PubChem CID: 93575 IUPAC Name: 2-(4-bromobutyl)isoindole-1,3-dione SMILES: BrCCCCN1C(=O)C2=CC=CC=C2C1=O
| PubChem CID | 93575 |
|---|---|
| CAS | 5394-18-3 |
| Molecular Weight (g/mol) | 282.14 |
| MDL Number | MFCD00005905 |
| SMILES | BrCCCCN1C(=O)C2=CC=CC=C2C1=O |
| Synonym | n-4-bromobutyl phthalimide,2-4-bromobutyl isoindoline-1,3-dione,1h-isoindole-1,3 2h-dione, 2-4-bromobutyl,2-4-bromobutyl-1h-isoindole-1,3 2h-dione,n-4-bromobutyl-phthalimide,2-4-bromobutyl isoindole-1,3-dione,2-4-bromobutyl-2,3-dihydro-1h-isoindole-1,3-dione,n-4-bromobutyl,n-bromobutylphthalimide |
| IUPAC Name | 2-(4-bromobutyl)isoindole-1,3-dione |
| InChI Key | UXFWTIGUWHJKDD-UHFFFAOYSA-N |
| Molecular Formula | C12H12BrNO2 |
Methyl cyclohexanecarboxylate, 98%
CAS: 4630-82-4 Molecular Formula: C8H14O2 Molecular Weight (g/mol): 142.20 MDL Number: MFCD00001458 InChI Key: ZQWPRMPSCMSAJU-UHFFFAOYSA-N Synonym: cyclohexanecarboxylic acid, methyl ester,methyl cyclohexanoate,methyl cyclohexylcarboxylate,cyclohexanecarboxylic acid methyl ester,hexahydrobenzoic acid methyl ester,methyl cyclohexylformate,methyl hexahydrobenzoate,methyl cyclohexane carboxylate,fema no. 3568,methyl ester of cyclohexanecarboxylic acid PubChem CID: 20748 IUPAC Name: methyl cyclohexanecarboxylate SMILES: COC(=O)C1CCCCC1
| PubChem CID | 20748 |
|---|---|
| CAS | 4630-82-4 |
| Molecular Weight (g/mol) | 142.20 |
| MDL Number | MFCD00001458 |
| SMILES | COC(=O)C1CCCCC1 |
| Synonym | cyclohexanecarboxylic acid, methyl ester,methyl cyclohexanoate,methyl cyclohexylcarboxylate,cyclohexanecarboxylic acid methyl ester,hexahydrobenzoic acid methyl ester,methyl cyclohexylformate,methyl hexahydrobenzoate,methyl cyclohexane carboxylate,fema no. 3568,methyl ester of cyclohexanecarboxylic acid |
| IUPAC Name | methyl cyclohexanecarboxylate |
| InChI Key | ZQWPRMPSCMSAJU-UHFFFAOYSA-N |
| Molecular Formula | C8H14O2 |
2-Sulfobenzoic acid cyclic anhydride, 95%
CAS: 81-08-3 Molecular Formula: C7H4O4S Molecular Weight (g/mol): 184.17 MDL Number: MFCD00005879 InChI Key: NCYNKWQXFADUOZ-UHFFFAOYSA-N Synonym: 2-sulfobenzoic anhydride,2-sulfobenzoic acid cyclic anhydride,sulfobenzoic anhydride,o-sulfobenzoic acid anhydride,3h-2,1-benzoxathiol-3-one, 1,1-dioxide,3h-benzo c 1,2 oxathiol-3-one 1,1-dioxide,unii-0swh68iq5w,o-sulfobenzoic acid, cyclic anhydride,2,1-benzoxathiol-3-one-1,1-dioxide,0swh68iq5w PubChem CID: 65729 IUPAC Name: 1,1-dioxo-2,1$l^{6}-benzoxathiol-3-one SMILES: C1=CC=C2C(=C1)C(=O)OS2(=O)=O
| PubChem CID | 65729 |
|---|---|
| CAS | 81-08-3 |
| Molecular Weight (g/mol) | 184.17 |
| MDL Number | MFCD00005879 |
| SMILES | C1=CC=C2C(=C1)C(=O)OS2(=O)=O |
| Synonym | 2-sulfobenzoic anhydride,2-sulfobenzoic acid cyclic anhydride,sulfobenzoic anhydride,o-sulfobenzoic acid anhydride,3h-2,1-benzoxathiol-3-one, 1,1-dioxide,3h-benzo c 1,2 oxathiol-3-one 1,1-dioxide,unii-0swh68iq5w,o-sulfobenzoic acid, cyclic anhydride,2,1-benzoxathiol-3-one-1,1-dioxide,0swh68iq5w |
| IUPAC Name | 1,1-dioxo-2,1$l^{6}-benzoxathiol-3-one |
| InChI Key | NCYNKWQXFADUOZ-UHFFFAOYSA-N |
| Molecular Formula | C7H4O4S |
Sodium oxalate, For ACS analysis, 99.96%, MP Biomedicals™
CAS: 62-76-0 Molecular Formula: C2Na2O4 Molecular Weight (g/mol): 134 MDL Number: MFCD00012465 InChI Key: ZNCPFRVNHGOPAG-UHFFFAOYSA-L Synonym: sodium oxalate,disodium oxalate,natriumoxalat,ethanedioic acid, disodium salt,oxalic acid, disodium salt,natriumoxalat german,stavelan sodny czech,oxalic acid disodium salt,unii-7u0v68lt9x,ethanedioic acid disodium salt PubChem CID: 6125 IUPAC Name: disodium oxalate SMILES: [Na+].[Na+].[O-]C(=O)C([O-])=O
| PubChem CID | 6125 |
|---|---|
| CAS | 62-76-0 |
| Molecular Weight (g/mol) | 134 |
| MDL Number | MFCD00012465 |
| SMILES | [Na+].[Na+].[O-]C(=O)C([O-])=O |
| Synonym | sodium oxalate,disodium oxalate,natriumoxalat,ethanedioic acid, disodium salt,oxalic acid, disodium salt,natriumoxalat german,stavelan sodny czech,oxalic acid disodium salt,unii-7u0v68lt9x,ethanedioic acid disodium salt |
| IUPAC Name | disodium oxalate |
| InChI Key | ZNCPFRVNHGOPAG-UHFFFAOYSA-L |
| Molecular Formula | C2Na2O4 |
Methyl chloroacetate, 98%
CAS: 96-34-4 Molecular Formula: C3H5ClO2 Molecular Weight (g/mol): 108.52 MDL Number: MFCD00000931 InChI Key: QABLOFMHHSOFRJ-UHFFFAOYSA-N Synonym: methyl chloroacetate,chloroacetic acid methyl ester,methyl monochloroacetate,methyl chloroethanoate,acetic acid, chloro-, methyl ester,methyl monochloracetate,methyl alpha-chloroacetate,methylchloroacetate,unii-450vsb182i,ccris 7749 PubChem CID: 7295 IUPAC Name: methyl 2-chloroacetate SMILES: COC(=O)CCl
| PubChem CID | 7295 |
|---|---|
| CAS | 96-34-4 |
| Molecular Weight (g/mol) | 108.52 |
| MDL Number | MFCD00000931 |
| SMILES | COC(=O)CCl |
| Synonym | methyl chloroacetate,chloroacetic acid methyl ester,methyl monochloroacetate,methyl chloroethanoate,acetic acid, chloro-, methyl ester,methyl monochloracetate,methyl alpha-chloroacetate,methylchloroacetate,unii-450vsb182i,ccris 7749 |
| IUPAC Name | methyl 2-chloroacetate |
| InChI Key | QABLOFMHHSOFRJ-UHFFFAOYSA-N |
| Molecular Formula | C3H5ClO2 |
Methyl thiophene-3-carboxylate, 97%, Thermo Scientific Chemicals
CAS: 22913-26-4 Molecular Formula: C6H6O2S Molecular Weight (g/mol): 142.17 MDL Number: MFCD06203810 InChI Key: ZTRAEMILTFNZSM-UHFFFAOYSA-N Synonym: methyl 3-thiophenecarboxylate,3-thiophenecarboxylic acid, methyl ester,thiophene-3-carboxylic acid methyl ester,3-thiophenecarboxylicacid, methyl ester,methyl thiophen-3-carboxylate,methyl-3-thenoate,methyl 3-thenoate,3-methoxycarbonylthiophene,3-methoxy carbonyl-thiophene,methyl 3-thiophenecarboxylate # PubChem CID: 574151 IUPAC Name: methyl thiophene-3-carboxylate SMILES: COC(=O)C1=CSC=C1
| PubChem CID | 574151 |
|---|---|
| CAS | 22913-26-4 |
| Molecular Weight (g/mol) | 142.17 |
| MDL Number | MFCD06203810 |
| SMILES | COC(=O)C1=CSC=C1 |
| Synonym | methyl 3-thiophenecarboxylate,3-thiophenecarboxylic acid, methyl ester,thiophene-3-carboxylic acid methyl ester,3-thiophenecarboxylicacid, methyl ester,methyl thiophen-3-carboxylate,methyl-3-thenoate,methyl 3-thenoate,3-methoxycarbonylthiophene,3-methoxy carbonyl-thiophene,methyl 3-thiophenecarboxylate # |
| IUPAC Name | methyl thiophene-3-carboxylate |
| InChI Key | ZTRAEMILTFNZSM-UHFFFAOYSA-N |
| Molecular Formula | C6H6O2S |